C17H17N7O — CID 157016460
N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-9-methylpurin-2-amine (PubChem CID 157016460) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-9-methylpurin-2-amine.
| Compound Name | N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-9-methylpurin-2-amine |
|---|---|
| PubChem CID | 157016460 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[[1-(3-methoxyphenyl)pyrazol-4-yl]methyl]-9-methylpurin-2-amine |
| SMILES | COc1cccc(-n2cc(CNc3ncc4ncn(C)c4n3)cn2)c1 |
| InChI | InChI=1S/C17H17N7O/c1-23-11-20-15-9-19-17(22-16(15)23)18-7-12-8-21-24(10-12)13-4-3-5-14(6-13)25-2/h3-6,8-11H,7H2,1-2H3,(H,18,19,22) |
| InChIKey | TWSJNKYCQLWMHE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |