C11H10N10OS — CID 157016835
N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 157016835) has the molecular formula C11H10N10OS and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 157016835 |
| Molecular Formula | C11H10N10OS |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]-3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Cc1nn2cc(CNC(=O)c3nc(-n4cnnc4)n[nH]3)nc2s1 |
| InChI | InChI=1S/C11H10N10OS/c1-6-19-21-3-7(15-11(21)23-6)2-12-9(22)8-16-10(18-17-8)20-4-13-14-5-20/h3-5H,2H2,1H3,(H,12,22)(H,16,17,18) |
| InChIKey | VESHPXNRWGOHEP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |