C15H19ClN2O3 — CID 157017018
N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-5-chloro-N-methyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 157017018) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-5-chloro-N-methyl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-5-chloro-N-methyl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157017018 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-5-chloro-N-methyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN(C(=O)c1c[nH]c(=O)c(Cl)c1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-18(11-2-8-4-12(19)5-9(8)3-11)15(21)10-6-13(16)14(20)17-7-10/h6-9,11-12,19H,2-5H2,1H3,(H,17,20)/t8-,9+,11?,12? |
| InChIKey | DHHDPMJSEYIOOS-LRSDLPTKSA-N |
| XLogP | 1.65 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |