C20H21NO2S — CID 157019842
(3aS,6aS)-5-(9H-fluoren-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide (PubChem CID 157019842) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is (3aS,6aS)-5-(9H-fluoren-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (3aS,6aS)-5-(9H-fluoren-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 157019842 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (3aS,6aS)-5-(9H-fluoren-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H]2CN(Cc3ccc4c(c3)Cc3ccccc3-4)C[C@H]21 |
| InChI | InChI=1S/C20H21NO2S/c22-24(23)8-7-16-12-21(13-20(16)24)11-14-5-6-19-17(9-14)10-15-3-1-2-4-18(15)19/h1-6,9,16,20H,7-8,10-13H2/t16-,20+/m0/s1 |
| InChIKey | ROIQJTXSISMWFU-OXJNMPFZSA-N |
| XLogP | 2.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |