C29H31N8+ — CID 15702115
2-[3-(1,3-diethylimidazo[4,5-b]quinoxalin-3-ium-2-yl)prop-2-enylidene]-1,3-diethylimidazo[4,5-b]quinoxaline (PubChem CID 15702115) has the molecular formula C29H31N8+ and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-[3-(1,3-diethylimidazo[4,5-b]quinoxalin-3-ium-2-yl)prop-2-enylidene]-1,3-diethylimidazo[4,5-b]quinoxaline.
| Compound Name | 2-[3-(1,3-diethylimidazo[4,5-b]quinoxalin-3-ium-2-yl)prop-2-enylidene]-1,3-diethylimidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 15702115 |
| Molecular Formula | C29H31N8+ |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-[3-(1,3-diethylimidazo[4,5-b]quinoxalin-3-ium-2-yl)prop-2-enylidene]-1,3-diethylimidazo[4,5-b]quinoxaline |
| SMILES | CCN1C(=CC=Cc2n(CC)c3nc4ccccc4nc3[n+]2CC)N(CC)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C29H31N8/c1-5-34-24(35(6-2)27-26(34)30-20-14-9-10-15-21(20)31-27)18-13-19-25-36(7-3)28-29(37(25)8-4)33-23-17-12-11-16-22(23)32-28/h9-19H,5-8H2,1-4H3/q+1 |
| InChIKey | BFDVZERJUHRTPK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|