About 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde
4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde (PubChem CID 157021873) has the molecular formula C14H16FNO2
and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde |
| PubChem CID | 157021873 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(OC2C[C@H]3CC[C@@H](C2)N3)cc1F |
| InChI | InChI=1S/C14H16FNO2/c15-14-7-12(4-1-9(14)8-17)18-13-5-10-2-3-11(6-13)16-10/h1,4,7-8,10-11,13,16H,2-3,5-6H2/t10-,11+,13? |
| InChIKey | CLNIEZZHDGAYDH-QYJAPNMZSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The IUPAC name of 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde (CID 157021873) is 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde.
What is the SMILES notation for 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The canonical SMILES for 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde is O=Cc1ccc(OC2C[C@H]3CC[C@@H](C2)N3)cc1F.
What is the InChIKey of 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The InChIKey is CLNIEZZHDGAYDH-QYJAPNMZSA-N. The full InChI is InChI=1S/C14H16FNO2/c15-14-7-12(4-1-9(14)8-17)18-13-5-10-2-3-11(6-13)16-10/h1,4,7-8,10-11,13,16H,2-3,5-6H2/t10-,11+,13?.
What are the key properties of 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde has a molecular weight of 249.28 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde is sourced from PubChem (CID 157021873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).