C29H30N6O — CID 157023165
[6-[3-(5-aminoindol-1-yl)prop-1-ynyl]-3-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]pyrazin-2-yl]methanol (PubChem CID 157023165) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is [6-[3-(5-aminoindol-1-yl)prop-1-ynyl]-3-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-[3-(5-aminoindol-1-yl)prop-1-ynyl]-3-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 157023165 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | [6-[3-(5-aminoindol-1-yl)prop-1-ynyl]-3-[(1S)-1-aminospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]pyrazin-2-yl]methanol |
| SMILES | Nc1ccc2c(ccn2CC#Cc2cnc(N3CCC4(CC3)Cc3ccccc3[C@H]4N)c(CO)n2)c1 |
| InChI | InChI=1S/C29H30N6O/c30-22-7-8-26-20(16-22)9-13-34(26)12-3-5-23-18-32-28(25(19-36)33-23)35-14-10-29(11-15-35)17-21-4-1-2-6-24(21)27(29)31/h1-2,4,6-9,13,16,18,27,36H,10-12,14-15,17,19,30-31H2/t27-/m1/s1 |
| InChIKey | YFNQOZDWECIUFW-HHHXNRCGSA-N |
| XLogP | 3.40 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|