About 5-bromo-2-phenyl-2,3-dihydrochromen-4-one
5-bromo-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 157023353) has the molecular formula C15H11BrO2
and a molecular weight of 303.15 g/mol. Its IUPAC name is 5-bromo-2-phenyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 5-bromo-2-phenyl-2,3-dihydrochromen-4-one |
| PubChem CID | 157023353 |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 5-bromo-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccccc2)Oc2cccc(Br)c21 |
| InChI | InChI=1S/C15H11BrO2/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-8,14H,9H2 |
| InChIKey | ZUTDWAUOAUUKPM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-phenyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-phenyl-2,3-dihydrochromen-4-one?
The IUPAC name of 5-bromo-2-phenyl-2,3-dihydrochromen-4-one (CID 157023353) is 5-bromo-2-phenyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 5-bromo-2-phenyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 5-bromo-2-phenyl-2,3-dihydrochromen-4-one is O=C1CC(c2ccccc2)Oc2cccc(Br)c21.
What is the InChIKey of 5-bromo-2-phenyl-2,3-dihydrochromen-4-one?
The InChIKey is ZUTDWAUOAUUKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO2/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-8,14H,9H2.
What are the key properties of 5-bromo-2-phenyl-2,3-dihydrochromen-4-one?
5-bromo-2-phenyl-2,3-dihydrochromen-4-one has a molecular weight of 303.15 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-phenyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 157023353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).