C31H31FN4O4 — CID 157023645
6-fluoro-7-(3-hydroxynaphthalen-1-yl)-1-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 157023645) has the molecular formula C31H31FN4O4 and a molecular weight of 542.61 g/mol. Its IUPAC name is 6-fluoro-7-(3-hydroxynaphthalen-1-yl)-1-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-fluoro-7-(3-hydroxynaphthalen-1-yl)-1-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 157023645 |
| Molecular Formula | C31H31FN4O4 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 6-fluoro-7-(3-hydroxynaphthalen-1-yl)-1-[[(2S)-1-methylpyrrolidin-2-yl]methyl]-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(C[C@@H]3CCCN3C)c3cc(-c4cc(O)cc5ccccc45)c(F)cc32)C1 |
| InChI | InChI=1S/C31H31FN4O4/c1-3-29(38)34-15-19(16-34)17-35-28-14-26(32)25(24-12-22(37)11-20-7-4-5-9-23(20)24)13-27(28)36(31(40)30(35)39)18-21-8-6-10-33(21)2/h3-5,7,9,11-14,19,21,37H,1,6,8,10,15-18H2,2H3/t21-/m0/s1 |
| InChIKey | ZXFCFOKYVWFMEK-NRFANRHFSA-N |
| XLogP | 3.57 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|