C30H26ClF2N3O4 — CID 157023658
6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 157023658) has the molecular formula C30H26ClF2N3O4 and a molecular weight of 566.00 g/mol. Its IUPAC name is 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 157023658 |
| Molecular Formula | C30H26ClF2N3O4 |
| Molecular Weight | 566.00 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3ccccc3C(C)C)c3cc(-c4c(O)ccc(F)c4F)c(Cl)cc32)C1 |
| InChI | InChI=1S/C30H26ClF2N3O4/c1-4-26(38)34-13-17(14-34)15-35-23-12-20(31)19(27-25(37)10-9-21(32)28(27)33)11-24(23)36(30(40)29(35)39)22-8-6-5-7-18(22)16(2)3/h4-12,16-17,37H,1,13-15H2,2-3H3 |
| InChIKey | VOYGATDELCKCRB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.00 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|