C31H28ClF2N3O4 — CID 157023661
6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 157023661) has the molecular formula C31H28ClF2N3O4 and a molecular weight of 580.03 g/mol. Its IUPAC name is 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 157023661 |
| Molecular Formula | C31H28ClF2N3O4 |
| Molecular Weight | 580.03 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 6-chloro-7-(2,3-difluoro-6-hydroxyphenyl)-1-(2-methyl-6-propan-2-ylphenyl)-4-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3c(C)cccc3C(C)C)c3cc(-c4c(O)ccc(F)c4F)c(Cl)cc32)C1 |
| InChI | InChI=1S/C31H28ClF2N3O4/c1-5-26(39)35-13-18(14-35)15-36-23-12-21(32)20(27-25(38)10-9-22(33)28(27)34)11-24(23)37(31(41)30(36)40)29-17(4)7-6-8-19(29)16(2)3/h5-12,16,18,38H,1,13-15H2,2-4H3 |
| InChIKey | SKCMPTBXSBRARO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|