C31H27Cl3FN3O4 — CID 157023665
7-chloro-6-(2,4-dichloro-5-hydroxyphenyl)-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione (PubChem CID 157023665) has the molecular formula C31H27Cl3FN3O4 and a molecular weight of 630.93 g/mol. Its IUPAC name is 7-chloro-6-(2,4-dichloro-5-hydroxyphenyl)-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 7-chloro-6-(2,4-dichloro-5-hydroxyphenyl)-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 157023665 |
| Molecular Formula | C31H27Cl3FN3O4 |
| Molecular Weight | 630.93 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | 7-chloro-6-(2,4-dichloro-5-hydroxyphenyl)-5-fluoro-4-(2-methyl-6-propan-2-ylphenyl)-1-[(1-prop-2-enoylazetidin-3-yl)methyl]quinoxaline-2,3-dione |
| SMILES | C=CC(=O)N1CC(Cn2c(=O)c(=O)n(-c3c(C)cccc3C(C)C)c3c(F)c(-c4cc(O)c(Cl)cc4Cl)c(Cl)cc32)C1 |
| InChI | InChI=1S/C31H27Cl3FN3O4/c1-5-25(40)36-12-17(13-36)14-37-23-11-22(34)26(19-9-24(39)21(33)10-20(19)32)27(35)29(23)38(31(42)30(37)41)28-16(4)7-6-8-18(28)15(2)3/h5-11,15,17,39H,1,12-14H2,2-4H3 |
| InChIKey | WMRZKCZJFGDNOB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.93 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|