C23H24ClF3N12O2 — CID 157024783
N-[2-[[(2S)-2-amino-3-(diaminomethylideneamino)propanoyl]amino]ethyl]-2-chloro-4-[[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide (PubChem CID 157024783) has the molecular formula C23H24ClF3N12O2 and a molecular weight of 592.97 g/mol. Its IUPAC name is N-[2-[[(2S)-2-amino-3-(diaminomethylideneamino)propanoyl]amino]ethyl]-2-chloro-4-[[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide.
| Compound Name | N-[2-[[(2S)-2-amino-3-(diaminomethylideneamino)propanoyl]amino]ethyl]-2-chloro-4-[[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
|---|---|
| PubChem CID | 157024783 |
| Molecular Formula | C23H24ClF3N12O2 |
| Molecular Weight | 592.97 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | N-[2-[[(2S)-2-amino-3-(diaminomethylideneamino)propanoyl]amino]ethyl]-2-chloro-4-[[3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
| SMILES | NC(N)=NC[C@H](N)C(=O)NCCNC(=O)c1ccc(Nc2nccn3c(-c4cn[nH]c4C(F)(F)F)cnc23)cc1Cl |
| InChI | InChI=1S/C23H24ClF3N12O2/c24-14-7-11(1-2-12(14)20(40)32-3-4-33-21(41)15(28)9-35-22(29)30)37-18-19-34-10-16(39(19)6-5-31-18)13-8-36-38-17(13)23(25,26)27/h1-2,5-8,10,15H,3-4,9,28H2,(H,31,37)(H,32,40)(H,33,41)(H,36,38)(H4,29,30,35)/t15-/m0/s1 |
| InChIKey | ZNFAXBOKSUJAJI-HNNXBMFYSA-N |
| XLogP | 0.98 |
| TPSA | 219.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.97 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|