C27H31F3N8O2 — CID 157025405
N-[2-[(2S)-2-aminopropoxy]ethyl]-2-ethyl-4-[[3-[1-prop-2-enyl-3-(trifluoromethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide (PubChem CID 157025405) has the molecular formula C27H31F3N8O2 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-[2-[(2S)-2-aminopropoxy]ethyl]-2-ethyl-4-[[3-[1-prop-2-enyl-3-(trifluoromethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide.
| Compound Name | N-[2-[(2S)-2-aminopropoxy]ethyl]-2-ethyl-4-[[3-[1-prop-2-enyl-3-(trifluoromethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
|---|---|
| PubChem CID | 157025405 |
| Molecular Formula | C27H31F3N8O2 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[2-[(2S)-2-aminopropoxy]ethyl]-2-ethyl-4-[[3-[1-prop-2-enyl-3-(trifluoromethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
| SMILES | C=CCn1cc(-c2cnc3c(Nc4ccc(C(=O)NCCOC[C@H](C)N)c(CC)c4)nccn23)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C27H31F3N8O2/c1-4-10-37-15-21(23(36-37)27(28,29)30)22-14-34-25-24(32-8-11-38(22)25)35-19-6-7-20(18(5-2)13-19)26(39)33-9-12-40-16-17(3)31/h4,6-8,11,13-15,17H,1,5,9-10,12,16,31H2,2-3H3,(H,32,35)(H,33,39)/t17-/m0/s1 |
| InChIKey | ZZLNZARJXGIOMP-KRWDZBQOSA-N |
| XLogP | 4.20 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|