C28H34N4O3 — CID 157025874
(R)-(1,3-dimethylazetidin-3-yl)-[5-[3-[(1S,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]-(4-propan-2-ylphenyl)methanol (PubChem CID 157025874) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is (R)-(1,3-dimethylazetidin-3-yl)-[5-[3-[(1S,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]-(4-propan-2-ylphenyl)methanol.
| Compound Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-[3-[(1S,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]-(4-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 157025874 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-[3-[(1S,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazol-5-yl]-3-pyridinyl]-(4-propan-2-ylphenyl)methanol |
| SMILES | CC(C)c1ccc([C@](O)(c2cncc(-c3nc([C@@H]4C[C@H]5CC[C@@H]4O5)no3)c2)C2(C)CN(C)C2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-17(2)18-5-7-20(8-6-18)28(33,27(3)15-32(4)16-27)21-11-19(13-29-14-21)26-30-25(31-35-26)23-12-22-9-10-24(23)34-22/h5-8,11,13-14,17,22-24,33H,9-10,12,15-16H2,1-4H3/t22-,23-,24+,28+/m1/s1 |
| InChIKey | QLXRJOAAJCZSQC-DFIMXKNXSA-N |
| XLogP | 4.48 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |