C22H30O3 — CID 157026692
17-acetyl-8,10,13-trimethyl-1,2,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6-dione (PubChem CID 157026692) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 17-acetyl-8,10,13-trimethyl-1,2,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | 17-acetyl-8,10,13-trimethyl-1,2,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 157026692 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 17-acetyl-8,10,13-trimethyl-1,2,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6-dione |
| SMILES | CC(=O)C1CCC2C1(C)CCC1C3(C)CCC(=O)C=C3C(=O)CC12C |
| InChI | InChI=1S/C22H30O3/c1-13(23)15-5-6-18-20(15,2)10-8-19-21(3)9-7-14(24)11-16(21)17(25)12-22(18,19)4/h11,15,18-19H,5-10,12H2,1-4H3 |
| InChIKey | OIJUONRVNRHRAJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |