About ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen
ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen (PubChem CID 157026945) has the molecular formula C15H30N2O3S
and a molecular weight of 318.48 g/mol. Its IUPAC name is ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen |
| PubChem CID | 157026945 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen |
| SMILES | CC.CC.CC1=CC(=O)N(CCC(=O)NCC(C)S)C1=O.[H][H] |
| InChI | InChI=1S/C11H16N2O3S.2C2H6.H2/c1-7-5-10(15)13(11(7)16)4-3-9(14)12-6-8(2)17;2*1-2;/h5,8,17H,3-4,6H2,1-2H3,(H,12,14);2*1-2H3;1H |
| InChIKey | SZRUDIIPUSAGCU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen?
The IUPAC name of ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen (CID 157026945) is ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen.
What is the SMILES notation for ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen?
The canonical SMILES for ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen is CC.CC.CC1=CC(=O)N(CCC(=O)NCC(C)S)C1=O.[H][H].
What is the InChIKey of ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen?
The InChIKey is SZRUDIIPUSAGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S.2C2H6.H2/c1-7-5-10(15)13(11(7)16)4-3-9(14)12-6-8(2)17;2*1-2;/h5,8,17H,3-4,6H2,1-2H3,(H,12,14);2*1-2H3;1H.
What are the key properties of ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen?
ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen has a molecular weight of 318.48 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-methyl-2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide;molecular hydrogen is sourced from PubChem (CID 157026945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).