C32H25F6N3O3 — CID 157027916
6-[2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetyl]-2-(1-phenylcyclopropyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 157027916) has the molecular formula C32H25F6N3O3 and a molecular weight of 613.56 g/mol. Its IUPAC name is 6-[2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetyl]-2-(1-phenylcyclopropyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetyl]-2-(1-phenylcyclopropyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 157027916 |
| Molecular Formula | C32H25F6N3O3 |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 6-[2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-hydroxyacetyl]-2-(1-phenylcyclopropyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=C(C(O)c1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1)N1CCc2nc(C3(c4ccccc4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C32H25F6N3O3/c33-31(34,35)22-14-20(15-23(16-22)32(36,37)38)18-5-4-6-19(13-18)26(42)28(44)41-12-9-25-24(17-41)27(43)40-29(39-25)30(10-11-30)21-7-2-1-3-8-21/h1-8,13-16,26,42H,9-12,17H2,(H,39,40,43) |
| InChIKey | DLCPLDLUJVCMJD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |