C31H29ClN4O4 — CID 157027948
6-[(2R)-2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[3-(2-methoxy-4-pyridinyl)phenyl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 157027948) has the molecular formula C31H29ClN4O4 and a molecular weight of 557.05 g/mol. Its IUPAC name is 6-[(2R)-2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[3-(2-methoxy-4-pyridinyl)phenyl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 6-[(2R)-2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[3-(2-methoxy-4-pyridinyl)phenyl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 157027948 |
| Molecular Formula | C31H29ClN4O4 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 6-[(2R)-2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[3-(2-methoxy-4-pyridinyl)phenyl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | COc1cc(-c2cccc(C3(c4nc5c(c(=O)[nH]4)CN(C(=O)[C@H](O)c4cccc(Cl)c4)CCC5)CC3)c2)ccn1 |
| InChI | InChI=1S/C31H29ClN4O4/c1-40-26-17-20(10-13-33-26)19-5-2-7-22(15-19)31(11-12-31)30-34-25-9-4-14-36(18-24(25)28(38)35-30)29(39)27(37)21-6-3-8-23(32)16-21/h2-3,5-8,10,13,15-17,27,37H,4,9,11-12,14,18H2,1H3,(H,34,35,38)/t27-/m1/s1 |
| InChIKey | ZJCCCGJHZBASPX-HHHXNRCGSA-N |
| XLogP | 4.58 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |