C34H26F5N3O2S — CID 157028285
2-[1-[3-(1-benzothiophen-3-yl)phenyl]cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 157028285) has the molecular formula C34H26F5N3O2S and a molecular weight of 635.66 g/mol. Its IUPAC name is 2-[1-[3-(1-benzothiophen-3-yl)phenyl]cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-[1-[3-(1-benzothiophen-3-yl)phenyl]cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 157028285 |
| Molecular Formula | C34H26F5N3O2S |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | 2-[1-[3-(1-benzothiophen-3-yl)phenyl]cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C(N1CCCc2nc(C3(c4cccc(-c5csc6ccccc56)c4)CC3)[nH]c(=O)c2C1)C(F)(F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H26F5N3O2S/c35-33(36,22-8-4-9-23(17-22)34(37,38)39)31(44)42-15-5-11-27-25(18-42)29(43)41-30(40-27)32(13-14-32)21-7-3-6-20(16-21)26-19-45-28-12-2-1-10-24(26)28/h1-4,6-10,12,16-17,19H,5,11,13-15,18H2,(H,40,41,43) |
| InChIKey | OJEUEFNQOVSLLJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |