C13H29N3O — CID 157028583
ethane;N-methyl-4-(3-methylbutyl)piperazine-1-carboxamide (PubChem CID 157028583) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is ethane;N-methyl-4-(3-methylbutyl)piperazine-1-carboxamide.
| Compound Name | ethane;N-methyl-4-(3-methylbutyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 157028583 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | ethane;N-methyl-4-(3-methylbutyl)piperazine-1-carboxamide |
| SMILES | CC.CNC(=O)N1CCN(CCC(C)C)CC1 |
| InChI | InChI=1S/C11H23N3O.C2H6/c1-10(2)4-5-13-6-8-14(9-7-13)11(15)12-3;1-2/h10H,4-9H2,1-3H3,(H,12,15);1-2H3 |
| InChIKey | VFWAMOOUYJWCQL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |