About 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid
3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid (PubChem CID 157029555) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid |
| PubChem CID | 157029555 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid |
| SMILES | N[C@H]1CCC[C@@H]1OCCC(=O)O |
| InChI | InChI=1S/C8H15NO3/c9-6-2-1-3-7(6)12-5-4-8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7-/m0/s1 |
| InChIKey | RXKUCWMDAKZNPR-BQBZGAKWSA-N |
| XLogP | 0.36 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid?
The IUPAC name of 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid (CID 157029555) is 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid.
What is the SMILES notation for 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid?
The canonical SMILES for 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid is N[C@H]1CCC[C@@H]1OCCC(=O)O.
What is the InChIKey of 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid?
The InChIKey is RXKUCWMDAKZNPR-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15NO3/c9-6-2-1-3-7(6)12-5-4-8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7-/m0/s1.
What are the key properties of 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid?
3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid has a molecular weight of 173.21 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2S)-2-aminocyclopentyl]oxypropanoic acid is sourced from PubChem (CID 157029555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).