About ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine
ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine (PubChem CID 157029872) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine |
| PubChem CID | 157029872 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine |
| SMILES | CC.COc1cc2c(cn1)N(C)CC2 |
| InChI | InChI=1S/C9H12N2O.C2H6/c1-11-4-3-7-5-9(12-2)10-6-8(7)11;1-2/h5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | PSODTXFCQZYTFW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine?
The IUPAC name of ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine (CID 157029872) is ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine.
What is the SMILES notation for ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine?
The canonical SMILES for ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine is CC.COc1cc2c(cn1)N(C)CC2.
What is the InChIKey of ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine?
The InChIKey is PSODTXFCQZYTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C2H6/c1-11-4-3-7-5-9(12-2)10-6-8(7)11;1-2/h5-6H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine?
ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine has a molecular weight of 194.28 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methoxy-1-methyl-2,3-dihydropyrrolo[2,3-c]pyridine is sourced from PubChem (CID 157029872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).