About 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane
2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane (PubChem CID 157030413) has the molecular formula C16H34N4S
and a molecular weight of 314.54 g/mol. Its IUPAC name is 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane.
Molecular Properties
| Compound Name | 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane |
| PubChem CID | 157030413 |
| Molecular Formula | C16H34N4S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane |
| SMILES | CC.CC.CC1(C)CCCC(c2nc(N)c(NN)s2)CC1 |
| InChI | InChI=1S/C12H22N4S.2C2H6/c1-12(2)6-3-4-8(5-7-12)10-15-9(13)11(16-14)17-10;2*1-2/h8,16H,3-7,13-14H2,1-2H3;2*1-2H3 |
| InChIKey | IGNZMGQRYCHDNY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane?
The IUPAC name of 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane (CID 157030413) is 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane.
What is the SMILES notation for 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane?
The canonical SMILES for 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane is CC.CC.CC1(C)CCCC(c2nc(N)c(NN)s2)CC1.
What is the InChIKey of 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane?
The InChIKey is IGNZMGQRYCHDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4S.2C2H6/c1-12(2)6-3-4-8(5-7-12)10-15-9(13)11(16-14)17-10;2*1-2/h8,16H,3-7,13-14H2,1-2H3;2*1-2H3.
What are the key properties of 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane?
2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane has a molecular weight of 314.54 g/mol, XLogP of 5.14, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcycloheptyl)-5-hydrazinyl-1,3-thiazol-4-amine;ethane is sourced from PubChem (CID 157030413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).