C23H25F5N6O4 — CID 157030439
N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 157030439) has the molecular formula C23H25F5N6O4 and a molecular weight of 544.48 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 157030439 |
| Molecular Formula | C23H25F5N6O4 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)N[C@H](c1cn2ncc([C@@H](O)NC(=O)CCC(F)(F)F)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C23H25F5N6O4/c1-12-19(38-11-29-12)21(37)33-18(13-2-5-22(24,25)6-3-13)15-10-34-16(31-15)8-14(9-30-34)20(36)32-17(35)4-7-23(26,27)28/h8-11,13,18,20,36H,2-7H2,1H3,(H,32,35)(H,33,37)/t18-,20+/m0/s1 |
| InChIKey | ZEFNPHGLUWIJJT-AZUAARDMSA-N |
| XLogP | 3.77 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|