About 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane
2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane (PubChem CID 157030451) has the molecular formula C11H17F2NO2
and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane.
Molecular Properties
| Compound Name | 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane |
| PubChem CID | 157030451 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane |
| SMILES | C#CCNC(=O)CC1CC(F)(F)C1.COC |
| InChI | InChI=1S/C9H11F2NO.C2H6O/c1-2-3-12-8(13)4-7-5-9(10,11)6-7;1-3-2/h1,7H,3-6H2,(H,12,13);1-2H3 |
| InChIKey | MFGIHCDXNUFWQO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane?
The IUPAC name of 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane (CID 157030451) is 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane.
What is the SMILES notation for 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane?
The canonical SMILES for 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane is C#CCNC(=O)CC1CC(F)(F)C1.COC.
What is the InChIKey of 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane?
The InChIKey is MFGIHCDXNUFWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2NO.C2H6O/c1-2-3-12-8(13)4-7-5-9(10,11)6-7;1-3-2/h1,7H,3-6H2,(H,12,13);1-2H3.
What are the key properties of 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane?
2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane has a molecular weight of 233.26 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluorocyclobutyl)-N-prop-2-ynylacetamide;methoxymethane is sourced from PubChem (CID 157030451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).