C8H9F4N3 — CID 157031052
5-methyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole (PubChem CID 157031052) has the molecular formula C8H9F4N3 and a molecular weight of 223.17 g/mol. Its IUPAC name is 5-methyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole.
| Compound Name | 5-methyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole |
|---|---|
| PubChem CID | 157031052 |
| Molecular Formula | C8H9F4N3 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5-methyl-1-[(2,2,3,3-tetrafluorocyclobutyl)methyl]triazole |
| SMILES | Cc1cnnn1CC1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H9F4N3/c1-5-3-13-14-15(5)4-6-2-7(9,10)8(6,11)12/h3,6H,2,4H2,1H3 |
| InChIKey | QLSMZTZTFAFBQO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|