C25H29F5N6O4 — CID 157031518
N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 157031518) has the molecular formula C25H29F5N6O4 and a molecular weight of 572.54 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-propan-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-propan-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 157031518 |
| Molecular Formula | C25H29F5N6O4 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ocnc1C(=O)N[C@H](c1cn2ncc([C@@H](O)NC(=O)CCC(F)(F)F)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H29F5N6O4/c1-13(2)21-20(31-12-40-21)23(39)35-19(14-3-6-24(26,27)7-4-14)16-11-36-17(33-16)9-15(10-32-36)22(38)34-18(37)5-8-25(28,29)30/h9-14,19,22,38H,3-8H2,1-2H3,(H,34,37)(H,35,39)/t19-,22+/m0/s1 |
| InChIKey | FZANBOPIMFNKAJ-SIKLNZKXSA-N |
| XLogP | 4.59 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|