C10H6BN5O2 — CID 157032361
CID 157032361 (PubChem CID 157032361) has the molecular formula C10H6BN5O2 and a molecular weight of 239.00 g/mol.
| Compound Name | CID 157032361 |
|---|---|
| PubChem CID | 157032361 |
| Molecular Formula | C10H6BN5O2 |
| Molecular Weight | 239.00 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2c[nH]c(=O)[nH]c2=O)nn2ccnc12 |
| InChI | InChI=1S/C10H6BN5O2/c11-6-3-7(15-16-2-1-12-8(6)16)5-4-13-10(18)14-9(5)17/h1-4H,(H2,13,14,17,18) |
| InChIKey | WIXMPEDVEBYZSU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.00 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|