About propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole
propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole (PubChem CID 157032809) has the molecular formula C19H20F3N3
and a molecular weight of 347.38 g/mol. Its IUPAC name is propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole.
Molecular Properties
| Compound Name | propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole |
| PubChem CID | 157032809 |
| Molecular Formula | C19H20F3N3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole |
| SMILES | CC(C)C1CC1.FC(F)(F)c1ccc(-n2ncc3ccccc32)nc1 |
| InChI | InChI=1S/C13H8F3N3.C6H12/c14-13(15,16)10-5-6-12(17-8-10)19-11-4-2-1-3-9(11)7-18-19;1-5(2)6-3-4-6/h1-8H;5-6H,3-4H2,1-2H3 |
| InChIKey | DUQWOXZEDWGSSW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole?
The IUPAC name of propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole (CID 157032809) is propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole.
What is the SMILES notation for propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole?
The canonical SMILES for propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole is CC(C)C1CC1.FC(F)(F)c1ccc(-n2ncc3ccccc32)nc1.
What is the InChIKey of propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole?
The InChIKey is DUQWOXZEDWGSSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3N3.C6H12/c14-13(15,16)10-5-6-12(17-8-10)19-11-4-2-1-3-9(11)7-18-19;1-5(2)6-3-4-6/h1-8H;5-6H,3-4H2,1-2H3.
What are the key properties of propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole?
propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole has a molecular weight of 347.38 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylcyclopropane;1-[5-(trifluoromethyl)-2-pyridinyl]indazole is sourced from PubChem (CID 157032809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).