C18H16F5N7O2 — CID 157032977
5-[8-[8,8-difluoro-2-(2,2,2-trifluoroethyl)-2,6-diazaspiro[3.4]octan-6-yl]imidazo[1,2-b]pyridazin-6-yl]-1H-pyrimidine-2,4-dione (PubChem CID 157032977) has the molecular formula C18H16F5N7O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 5-[8-[8,8-difluoro-2-(2,2,2-trifluoroethyl)-2,6-diazaspiro[3.4]octan-6-yl]imidazo[1,2-b]pyridazin-6-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[8-[8,8-difluoro-2-(2,2,2-trifluoroethyl)-2,6-diazaspiro[3.4]octan-6-yl]imidazo[1,2-b]pyridazin-6-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157032977 |
| Molecular Formula | C18H16F5N7O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 5-[8-[8,8-difluoro-2-(2,2,2-trifluoroethyl)-2,6-diazaspiro[3.4]octan-6-yl]imidazo[1,2-b]pyridazin-6-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2cc(N3CC(F)(F)C4(CN(CC(F)(F)F)C4)C3)c3nccn3n2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H16F5N7O2/c19-17(20)8-29(7-16(17)5-28(6-16)9-18(21,22)23)12-3-11(27-30-2-1-24-13(12)30)10-4-25-15(32)26-14(10)31/h1-4H,5-9H2,(H2,25,26,31,32) |
| InChIKey | HGGBCLBEWGFQER-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |