C22H21F2N7O2 — CID 157033114
5-(8-cyclopropylimidazo[1,2-b]pyridazin-6-yl)-1H-pyrimidine-2,4-dione;N-(2,2-difluoroethyl)-2-methanimidoylaniline (PubChem CID 157033114) has the molecular formula C22H21F2N7O2 and a molecular weight of 453.45 g/mol. Its IUPAC name is 5-(8-cyclopropylimidazo[1,2-b]pyridazin-6-yl)-1H-pyrimidine-2,4-dione;N-(2,2-difluoroethyl)-2-methanimidoylaniline.
| Compound Name | 5-(8-cyclopropylimidazo[1,2-b]pyridazin-6-yl)-1H-pyrimidine-2,4-dione;N-(2,2-difluoroethyl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 157033114 |
| Molecular Formula | C22H21F2N7O2 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 5-(8-cyclopropylimidazo[1,2-b]pyridazin-6-yl)-1H-pyrimidine-2,4-dione;N-(2,2-difluoroethyl)-2-methanimidoylaniline |
| SMILES | O=c1[nH]cc(-c2cc(C3CC3)c3nccn3n2)c(=O)[nH]1.[H]/N=C/c1ccccc1NCC(F)F |
| InChI | InChI=1S/C13H11N5O2.C9H10F2N2/c19-12-9(6-15-13(20)16-12)10-5-8(7-1-2-7)11-14-3-4-18(11)17-10;10-9(11)6-13-8-4-2-1-3-7(8)5-12/h3-7H,1-2H2,(H2,15,16,19,20);1-5,9,12-13H,6H2/b;12-5+ |
| InChIKey | LXNACZDMYAVQGJ-UOMILQMYSA-N |
| XLogP | 3.01 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|