About 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile
5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile (PubChem CID 157033187) has the molecular formula C16H10ClFN4
and a molecular weight of 312.74 g/mol. Its IUPAC name is 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile |
| PubChem CID | 157033187 |
| Molecular Formula | C16H10ClFN4 |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc([C@H]2C[C@@H]2c2cc(Cl)nn3ccnc23)ccc1F |
| InChI | InChI=1S/C16H10ClFN4/c17-15-7-13(16-20-3-4-22(16)21-15)12-6-11(12)9-1-2-14(18)10(5-9)8-19/h1-5,7,11-12H,6H2/t11-,12+/m1/s1 |
| InChIKey | WMZDDQRTPXYUSH-NEPJUHHUSA-N |
| XLogP | 3.66 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile?
The IUPAC name of 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile (CID 157033187) is 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile.
What is the SMILES notation for 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile?
The canonical SMILES for 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile is N#Cc1cc([C@H]2C[C@@H]2c2cc(Cl)nn3ccnc23)ccc1F.
What is the InChIKey of 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile?
The InChIKey is WMZDDQRTPXYUSH-NEPJUHHUSA-N. The full InChI is InChI=1S/C16H10ClFN4/c17-15-7-13(16-20-3-4-22(16)21-15)12-6-11(12)9-1-2-14(18)10(5-9)8-19/h1-5,7,11-12H,6H2/t11-,12+/m1/s1.
What are the key properties of 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile?
5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile has a molecular weight of 312.74 g/mol, XLogP of 3.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-2-fluorobenzonitrile is sourced from PubChem (CID 157033187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).