C28H24F4N6O3 — CID 157033601
6'-[(1S,2S)-2-[6-(2,4-dimethoxypyrimidin-5-yl)-3-fluoroimidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-1'-(2,2,2-trifluoroethyl)spiro[cyclobutane-1,3'-indole]-2'-one (PubChem CID 157033601) has the molecular formula C28H24F4N6O3 and a molecular weight of 568.53 g/mol. Its IUPAC name is 6'-[(1S,2S)-2-[6-(2,4-dimethoxypyrimidin-5-yl)-3-fluoroimidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-1'-(2,2,2-trifluoroethyl)spiro[cyclobutane-1,3'-indole]-2'-one.
| Compound Name | 6'-[(1S,2S)-2-[6-(2,4-dimethoxypyrimidin-5-yl)-3-fluoroimidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-1'-(2,2,2-trifluoroethyl)spiro[cyclobutane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 157033601 |
| Molecular Formula | C28H24F4N6O3 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 6'-[(1S,2S)-2-[6-(2,4-dimethoxypyrimidin-5-yl)-3-fluoroimidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-1'-(2,2,2-trifluoroethyl)spiro[cyclobutane-1,3'-indole]-2'-one |
| SMILES | COc1ncc(-c2cc([C@H]3C[C@@H]3c3ccc4c(c3)N(CC(F)(F)F)C(=O)C43CCC3)c3ncc(F)n3n2)c(OC)n1 |
| InChI | InChI=1S/C28H24F4N6O3/c1-40-24-18(11-34-26(35-24)41-2)20-10-17(23-33-12-22(29)38(23)36-20)16-9-15(16)14-4-5-19-21(8-14)37(13-28(30,31)32)25(39)27(19)6-3-7-27/h4-5,8,10-12,15-16H,3,6-7,9,13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PBQQVBXQXXJBNQ-CVEARBPZSA-N |
| XLogP | 4.94 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |