About 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine
6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine (PubChem CID 157033725) has the molecular formula C10H9ClF2N4
and a molecular weight of 258.66 g/mol. Its IUPAC name is 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine |
| PubChem CID | 157033725 |
| Molecular Formula | C10H9ClF2N4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine |
| SMILES | FC1(F)CCN(c2cc(Cl)nn3ccnc23)C1 |
| InChI | InChI=1S/C10H9ClF2N4/c11-8-5-7(9-14-2-4-17(9)15-8)16-3-1-10(12,13)6-16/h2,4-5H,1,3,6H2 |
| InChIKey | ZQZHIKXDZODPKZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine?
The IUPAC name of 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine (CID 157033725) is 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine?
The canonical SMILES for 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine is FC1(F)CCN(c2cc(Cl)nn3ccnc23)C1.
What is the InChIKey of 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine?
The InChIKey is ZQZHIKXDZODPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2N4/c11-8-5-7(9-14-2-4-17(9)15-8)16-3-1-10(12,13)6-16/h2,4-5H,1,3,6H2.
What are the key properties of 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine?
6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine has a molecular weight of 258.66 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-(3,3-difluoropyrrolidin-1-yl)imidazo[1,2-b]pyridazine is sourced from PubChem (CID 157033725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).