C24H19F4N7O2 — CID 157034619
6-(2,4-dimethoxypyrimidin-5-yl)-8-[(1R,2R)-2-[3-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]imidazo[1,2-b]pyridazine (PubChem CID 157034619) has the molecular formula C24H19F4N7O2 and a molecular weight of 513.46 g/mol. Its IUPAC name is 6-(2,4-dimethoxypyrimidin-5-yl)-8-[(1R,2R)-2-[3-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]imidazo[1,2-b]pyridazine.
| Compound Name | 6-(2,4-dimethoxypyrimidin-5-yl)-8-[(1R,2R)-2-[3-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 157034619 |
| Molecular Formula | C24H19F4N7O2 |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 6-(2,4-dimethoxypyrimidin-5-yl)-8-[(1R,2R)-2-[3-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]imidazo[1,2-b]pyridazine |
| SMILES | COc1ncc(-c2cc([C@@H]3C[C@H]3c3ccc4c(F)nn(CC(F)(F)F)c4c3)c3nccn3n2)c(OC)n1 |
| InChI | InChI=1S/C24H19F4N7O2/c1-36-22-17(10-30-23(31-22)37-2)18-9-16(21-29-5-6-34(21)32-18)15-8-14(15)12-3-4-13-19(7-12)35(33-20(13)25)11-24(26,27)28/h3-7,9-10,14-15H,8,11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | HXINCVCTGUKDEA-LSDHHAIUSA-N |
| XLogP | 4.53 |
| TPSA | 92.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |