About 3-cyclopropyl-1,1-difluorocyclobutane
3-cyclopropyl-1,1-difluorocyclobutane (PubChem CID 157034703) has the molecular formula C7H10F2
and a molecular weight of 132.15 g/mol. Its IUPAC name is 3-cyclopropyl-1,1-difluorocyclobutane.
Molecular Properties
| Compound Name | 3-cyclopropyl-1,1-difluorocyclobutane |
| PubChem CID | 157034703 |
| Molecular Formula | C7H10F2 |
| Molecular Weight | 132.15 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3-cyclopropyl-1,1-difluorocyclobutane |
| SMILES | FC1(F)CC(C2CC2)C1 |
| InChI | InChI=1S/C7H10F2/c8-7(9)3-6(4-7)5-1-2-5/h5-6H,1-4H2 |
| InChIKey | MSVVFLATYFIWCP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-cyclopropyl-1,1-difluorocyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1,1-difluorocyclobutane?
The IUPAC name of 3-cyclopropyl-1,1-difluorocyclobutane (CID 157034703) is 3-cyclopropyl-1,1-difluorocyclobutane.
What is the SMILES notation for 3-cyclopropyl-1,1-difluorocyclobutane?
The canonical SMILES for 3-cyclopropyl-1,1-difluorocyclobutane is FC1(F)CC(C2CC2)C1.
What is the InChIKey of 3-cyclopropyl-1,1-difluorocyclobutane?
The InChIKey is MSVVFLATYFIWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2/c8-7(9)3-6(4-7)5-1-2-5/h5-6H,1-4H2.
What are the key properties of 3-cyclopropyl-1,1-difluorocyclobutane?
3-cyclopropyl-1,1-difluorocyclobutane has a molecular weight of 132.15 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1,1-difluorocyclobutane is sourced from PubChem (CID 157034703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).