C22H16ClF5N4O — CID 157034805
6'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-1'-(2,2,3,3,3-pentafluoropropyl)spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 157034805) has the molecular formula C22H16ClF5N4O and a molecular weight of 482.84 g/mol. Its IUPAC name is 6'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-1'-(2,2,3,3,3-pentafluoropropyl)spiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 6'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-1'-(2,2,3,3,3-pentafluoropropyl)spiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 157034805 |
| Molecular Formula | C22H16ClF5N4O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 6'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-1'-(2,2,3,3,3-pentafluoropropyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | O=C1N(CC(F)(F)C(F)(F)F)c2cc([C@H]3C[C@@H]3c3cc(Cl)nn4ccnc34)ccc2C12CC2 |
| InChI | InChI=1S/C22H16ClF5N4O/c23-17-9-14(18-29-5-6-32(18)30-17)13-8-12(13)11-1-2-15-16(7-11)31(19(33)20(15)3-4-20)10-21(24,25)22(26,27)28/h1-2,5-7,9,12-13H,3-4,8,10H2/t12-,13+/m1/s1 |
| InChIKey | LRXWZWQQIIUZGI-OLZOCXBDSA-N |
| XLogP | 5.23 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|