C14H15F3N2 — CID 157034963
5-[(1S,2S)-2-ethylcyclopropyl]-1-(2,2,2-trifluoroethyl)indazole (PubChem CID 157034963) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 5-[(1S,2S)-2-ethylcyclopropyl]-1-(2,2,2-trifluoroethyl)indazole.
| Compound Name | 5-[(1S,2S)-2-ethylcyclopropyl]-1-(2,2,2-trifluoroethyl)indazole |
|---|---|
| PubChem CID | 157034963 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-[(1S,2S)-2-ethylcyclopropyl]-1-(2,2,2-trifluoroethyl)indazole |
| SMILES | CC[C@H]1C[C@@H]1c1ccc2c(cnn2CC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2/c1-2-9-6-12(9)10-3-4-13-11(5-10)7-18-19(13)8-14(15,16)17/h3-5,7,9,12H,2,6,8H2,1H3/t9-,12-/m0/s1 |
| InChIKey | KYZSOXKSOGICOK-CABZTGNLSA-N |
| XLogP | 4.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |