C17H13Cl2NO3 — CID 157035695
2,6-dichloro-4-(3-phenylazetidine-1-carbonyl)benzoic acid (PubChem CID 157035695) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-phenylazetidine-1-carbonyl)benzoic acid.
| Compound Name | 2,6-dichloro-4-(3-phenylazetidine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 157035695 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2,6-dichloro-4-(3-phenylazetidine-1-carbonyl)benzoic acid |
| SMILES | O=C(O)c1c(Cl)cc(C(=O)N2CC(c3ccccc3)C2)cc1Cl |
| InChI | InChI=1S/C17H13Cl2NO3/c18-13-6-11(7-14(19)15(13)17(22)23)16(21)20-8-12(9-20)10-4-2-1-3-5-10/h1-7,12H,8-9H2,(H,22,23) |
| InChIKey | GEXMQLXNFWVNQE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |