C10H15N — CID 157035974
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]azetidine (PubChem CID 157035974) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]azetidine.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]azetidine |
|---|---|
| PubChem CID | 157035974 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]azetidine |
| SMILES | C=C/C=C\C(=C/C)C1CNC1 |
| InChI | InChI=1S/C10H15N/c1-3-5-6-9(4-2)10-7-11-8-10/h3-6,10-11H,1,7-8H2,2H3/b6-5-,9-4+ |
| InChIKey | AMBWDXJUJSIKIM-CXBDEZGUSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|