C32H47ClN4O5 — CID 157036138
tert-butyl 4-[4-amino-2-(2-oxa-7-azaspiro[3.4]octan-7-yl)benzoyl]-3-[(2E,4Z,6Z)-8-chloronona-2,4,6-trien-2-yl]piperazine-1-carboxylate;methanol (PubChem CID 157036138) has the molecular formula C32H47ClN4O5 and a molecular weight of 603.20 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-2-(2-oxa-7-azaspiro[3.4]octan-7-yl)benzoyl]-3-[(2E,4Z,6Z)-8-chloronona-2,4,6-trien-2-yl]piperazine-1-carboxylate;methanol.
| Compound Name | tert-butyl 4-[4-amino-2-(2-oxa-7-azaspiro[3.4]octan-7-yl)benzoyl]-3-[(2E,4Z,6Z)-8-chloronona-2,4,6-trien-2-yl]piperazine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 157036138 |
| Molecular Formula | C32H47ClN4O5 |
| Molecular Weight | 603.20 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | tert-butyl 4-[4-amino-2-(2-oxa-7-azaspiro[3.4]octan-7-yl)benzoyl]-3-[(2E,4Z,6Z)-8-chloronona-2,4,6-trien-2-yl]piperazine-1-carboxylate;methanol |
| SMILES | C/C(=C\C=C/C=C\C(C)Cl)C1CN(C(=O)OC(C)(C)C)CCN1C(=O)c1ccc(N)cc1N1CCC2(COC2)C1.CO |
| InChI | InChI=1S/C31H43ClN4O4.CH4O/c1-22(9-7-6-8-10-23(2)32)27-18-34(29(38)40-30(3,4)5)15-16-36(27)28(37)25-12-11-24(33)17-26(25)35-14-13-31(19-35)20-39-21-31;1-2/h6-12,17,23,27H,13-16,18-21,33H2,1-5H3;2H,1H3/b7-6-,10-8-,22-9+; |
| InChIKey | OXSBXNZSPRCIME-FKMWOGLHSA-N |
| XLogP | 4.85 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|