C12H9F8NO2 — CID 157036926
2,3,3,3-tetrafluoro-N,N-bis(prop-2-ynyl)-2-(2,3,3,3-tetrafluoropropoxy)propanamide (PubChem CID 157036926) has the molecular formula C12H9F8NO2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-N,N-bis(prop-2-ynyl)-2-(2,3,3,3-tetrafluoropropoxy)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-N,N-bis(prop-2-ynyl)-2-(2,3,3,3-tetrafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 157036926 |
| Molecular Formula | C12H9F8NO2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2,3,3,3-tetrafluoro-N,N-bis(prop-2-ynyl)-2-(2,3,3,3-tetrafluoropropoxy)propanamide |
| SMILES | C#CCN(CC#C)C(=O)C(F)(OCC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F8NO2/c1-3-5-21(6-4-2)9(22)10(14,12(18,19)20)23-7-8(13)11(15,16)17/h1-2,8H,5-7H2 |
| InChIKey | BUSNUNBJWQTPQP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|