C23H17F3N6O — CID 157037222
N-[4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-11-yl]-2-pyridin-2-ylacetamide (PubChem CID 157037222) has the molecular formula C23H17F3N6O and a molecular weight of 450.42 g/mol. Its IUPAC name is N-[4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-11-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-11-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 157037222 |
| Molecular Formula | C23H17F3N6O |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-11-yl]-2-pyridin-2-ylacetamide |
| SMILES | Cn1cc2c3nc(NC(=O)Cc4ccccn4)ccc3n(-c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C23H17F3N6O/c1-31-13-17-21-18(9-10-19(29-21)28-20(33)12-15-4-2-3-11-27-15)32(22(17)30-31)16-7-5-14(6-8-16)23(24,25)26/h2-11,13H,12H2,1H3,(H,28,29,33) |
| InChIKey | IOSVOHLKSZRJMA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |