C18H22N4O — CID 157037278
4-cyclohexyl-N,2-dimethylpyrazolo[4,3-b]indole-7-carboxamide (PubChem CID 157037278) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-cyclohexyl-N,2-dimethylpyrazolo[4,3-b]indole-7-carboxamide.
| Compound Name | 4-cyclohexyl-N,2-dimethylpyrazolo[4,3-b]indole-7-carboxamide |
|---|---|
| PubChem CID | 157037278 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-cyclohexyl-N,2-dimethylpyrazolo[4,3-b]indole-7-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)c1nn(C)cc1n2C1CCCCC1 |
| InChI | InChI=1S/C18H22N4O/c1-19-18(23)12-8-9-15-14(10-12)17-16(11-21(2)20-17)22(15)13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H,19,23) |
| InChIKey | WKIFRSNKOCEHED-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |