C17H11F3N4O2 — CID 157037585
4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaene-11-carboxylic acid (PubChem CID 157037585) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaene-11-carboxylic acid.
| Compound Name | 4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaene-11-carboxylic acid |
|---|---|
| PubChem CID | 157037585 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-methyl-7-[4-(trifluoromethyl)phenyl]-4,5,7,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,5,8,10-pentaene-11-carboxylic acid |
| SMILES | Cn1cc2c3cc(C(=O)O)ncc3n(-c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C17H11F3N4O2/c1-23-8-12-11-6-13(16(25)26)21-7-14(11)24(15(12)22-23)10-4-2-9(3-5-10)17(18,19)20/h2-8H,1H3,(H,25,26) |
| InChIKey | FXFFBACQOMVCDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |