C8H12FN3O — CID 157037813
N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]acetamide (PubChem CID 157037813) has the molecular formula C8H12FN3O and a molecular weight of 185.20 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]acetamide.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 157037813 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]acetamide |
| SMILES | CCn1ncc(CNC(C)=O)c1F |
| InChI | InChI=1S/C8H12FN3O/c1-3-12-8(9)7(5-11-12)4-10-6(2)13/h5H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | AYJBHAGCROZVDJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |