About 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid
2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid (PubChem CID 157037820) has the molecular formula C19H20F3N3O2
and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid |
| PubChem CID | 157037820 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid |
| SMILES | Cn1cc2c3cc(C(=O)O)ccc3n(CC3CCC(C(F)(F)F)CC3)c2n1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-24-10-15-14-8-12(18(26)27)4-7-16(14)25(17(15)23-24)9-11-2-5-13(6-3-11)19(20,21)22/h4,7-8,10-11,13H,2-3,5-6,9H2,1H3,(H,26,27) |
| InChIKey | YNFPGSWASZCWJR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid?
The IUPAC name of 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid (CID 157037820) is 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid.
What is the SMILES notation for 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid?
The canonical SMILES for 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid is Cn1cc2c3cc(C(=O)O)ccc3n(CC3CCC(C(F)(F)F)CC3)c2n1.
What is the InChIKey of 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid?
The InChIKey is YNFPGSWASZCWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3N3O2/c1-24-10-15-14-8-12(18(26)27)4-7-16(14)25(17(15)23-24)9-11-2-5-13(6-3-11)19(20,21)22/h4,7-8,10-11,13H,2-3,5-6,9H2,1H3,(H,26,27).
What are the key properties of 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid?
2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid has a molecular weight of 379.38 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrazolo[3,4-b]indole-7-carboxylic acid is sourced from PubChem (CID 157037820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).