About ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide
ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide (PubChem CID 157037933) has the molecular formula C12H26N4O
and a molecular weight of 242.37 g/mol. Its IUPAC name is ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide |
| PubChem CID | 157037933 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide |
| SMILES | CC.CC.CC(=O)NC(C)CCn1cncn1 |
| InChI | InChI=1S/C8H14N4O.2C2H6/c1-7(11-8(2)13)3-4-12-6-9-5-10-12;2*1-2/h5-7H,3-4H2,1-2H3,(H,11,13);2*1-2H3 |
| InChIKey | XCNHEKVAHOZBHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide?
The IUPAC name of ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide (CID 157037933) is ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide.
What is the SMILES notation for ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide?
The canonical SMILES for ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide is CC.CC.CC(=O)NC(C)CCn1cncn1.
What is the InChIKey of ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide?
The InChIKey is XCNHEKVAHOZBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O.2C2H6/c1-7(11-8(2)13)3-4-12-6-9-5-10-12;2*1-2/h5-7H,3-4H2,1-2H3,(H,11,13);2*1-2H3.
What are the key properties of ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide?
ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide has a molecular weight of 242.37 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[4-(1,2,4-triazol-1-yl)butan-2-yl]acetamide is sourced from PubChem (CID 157037933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).