About 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid
4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid (PubChem CID 157037963) has the molecular formula C18H21N3O2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid |
| PubChem CID | 157037963 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid |
| SMILES | Cn1cc2c3cc(C(=O)O)ccc3n(CC3CCCCC3)c2n1 |
| InChI | InChI=1S/C18H21N3O2/c1-20-11-15-14-9-13(18(22)23)7-8-16(14)21(17(15)19-20)10-12-5-3-2-4-6-12/h7-9,11-12H,2-6,10H2,1H3,(H,22,23) |
| InChIKey | YPEFPRXYZLVNDU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid?
The IUPAC name of 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid (CID 157037963) is 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid.
What is the SMILES notation for 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid?
The canonical SMILES for 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid is Cn1cc2c3cc(C(=O)O)ccc3n(CC3CCCCC3)c2n1.
What is the InChIKey of 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid?
The InChIKey is YPEFPRXYZLVNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2/c1-20-11-15-14-9-13(18(22)23)7-8-16(14)21(17(15)19-20)10-12-5-3-2-4-6-12/h7-9,11-12H,2-6,10H2,1H3,(H,22,23).
What are the key properties of 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid?
4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid has a molecular weight of 311.38 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylic acid is sourced from PubChem (CID 157037963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).